C5H12ClNS — CID 55302478
(1S)-2-chloro-N,N-dimethyl-1-methylsulfanylethanamine (PubChem CID 55302478) has the molecular formula C5H12ClNS and a molecular weight of 153.68 g/mol. Its IUPAC name is (1S)-2-chloro-N,N-dimethyl-1-methylsulfanylethanamine.
| Compound Name | (1S)-2-chloro-N,N-dimethyl-1-methylsulfanylethanamine |
|---|---|
| PubChem CID | 55302478 |
| Molecular Formula | C5H12ClNS |
| Molecular Weight | 153.68 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | (1S)-2-chloro-N,N-dimethyl-1-methylsulfanylethanamine |
| SMILES | CS[C@@H](CCl)N(C)C |
| InChI | InChI=1S/C5H12ClNS/c1-7(2)5(4-6)8-3/h5H,4H2,1-3H3/t5-/m0/s1 |
| InChIKey | JYOHHIPUJYUAGV-YFKPBYRVSA-N |
| XLogP | 1.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.68 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|