C4H11Cl2NO — CID 90102639
1,2-dichloro-N,N-dimethylethanamine;hydrate (PubChem CID 90102639) has the molecular formula C4H11Cl2NO and a molecular weight of 160.04 g/mol. Its IUPAC name is 1,2-dichloro-N,N-dimethylethanamine;hydrate.
| Compound Name | 1,2-dichloro-N,N-dimethylethanamine;hydrate |
|---|---|
| PubChem CID | 90102639 |
| Molecular Formula | C4H11Cl2NO |
| Molecular Weight | 160.04 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 1,2-dichloro-N,N-dimethylethanamine;hydrate |
| SMILES | CN(C)C(Cl)CCl.O |
| InChI | InChI=1S/C4H9Cl2N.H2O/c1-7(2)4(6)3-5;/h4H,3H2,1-2H3;1H2 |
| InChIKey | UEXSQXBMZVTBMT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.04 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|