About 1,2-dichloro-N,N-dimethylethanamine;hydrate
1,2-dichloro-N,N-dimethylethanamine;hydrate (PubChem CID 90102639) has the molecular formula C4H11Cl2NO
and a molecular weight of 160.04 g/mol. Its IUPAC name is 1,2-dichloro-N,N-dimethylethanamine;hydrate.
Molecular Properties
| Compound Name | 1,2-dichloro-N,N-dimethylethanamine;hydrate |
| PubChem CID | 90102639 |
| Molecular Formula | C4H11Cl2NO |
| Molecular Weight | 160.04 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 1,2-dichloro-N,N-dimethylethanamine;hydrate |
| SMILES | CN(C)C(Cl)CCl.O |
| InChI | InChI=1S/C4H9Cl2N.H2O/c1-7(2)4(6)3-5;/h4H,3H2,1-2H3;1H2 |
| InChIKey | UEXSQXBMZVTBMT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.04 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-N,N-dimethylethanamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-N,N-dimethylethanamine;hydrate?
The IUPAC name of 1,2-dichloro-N,N-dimethylethanamine;hydrate (CID 90102639) is 1,2-dichloro-N,N-dimethylethanamine;hydrate.
What is the SMILES notation for 1,2-dichloro-N,N-dimethylethanamine;hydrate?
The canonical SMILES for 1,2-dichloro-N,N-dimethylethanamine;hydrate is CN(C)C(Cl)CCl.O.
What is the InChIKey of 1,2-dichloro-N,N-dimethylethanamine;hydrate?
The InChIKey is UEXSQXBMZVTBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Cl2N.H2O/c1-7(2)4(6)3-5;/h4H,3H2,1-2H3;1H2.
What are the key properties of 1,2-dichloro-N,N-dimethylethanamine;hydrate?
1,2-dichloro-N,N-dimethylethanamine;hydrate has a molecular weight of 160.04 g/mol, XLogP of 0.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-N,N-dimethylethanamine;hydrate is sourced from PubChem (CID 90102639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).