C11H22Cl2N2O — CID 91127971
2,5-dichloro-5-(dimethylamino)-N,N-diethylpentanamide (PubChem CID 91127971) has the molecular formula C11H22Cl2N2O and a molecular weight of 269.22 g/mol. Its IUPAC name is 2,5-dichloro-5-(dimethylamino)-N,N-diethylpentanamide.
| Compound Name | 2,5-dichloro-5-(dimethylamino)-N,N-diethylpentanamide |
|---|---|
| PubChem CID | 91127971 |
| Molecular Formula | C11H22Cl2N2O |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2,5-dichloro-5-(dimethylamino)-N,N-diethylpentanamide |
| SMILES | CCN(CC)C(=O)C(Cl)CCC(Cl)N(C)C |
| InChI | InChI=1S/C11H22Cl2N2O/c1-5-15(6-2)11(16)9(12)7-8-10(13)14(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | SHUJXKAAEAHWAW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|