C7H20N4S — CID 123256655
2-[2-(ethylamino)hydrazinyl]-N,N-dimethyl-1-methylsulfanylethanamine (PubChem CID 123256655) has the molecular formula C7H20N4S and a molecular weight of 192.33 g/mol. Its IUPAC name is 2-[2-(ethylamino)hydrazinyl]-N,N-dimethyl-1-methylsulfanylethanamine.
| Compound Name | 2-[2-(ethylamino)hydrazinyl]-N,N-dimethyl-1-methylsulfanylethanamine |
|---|---|
| PubChem CID | 123256655 |
| Molecular Formula | C7H20N4S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-[2-(ethylamino)hydrazinyl]-N,N-dimethyl-1-methylsulfanylethanamine |
| SMILES | CCNNNCC(SC)N(C)C |
| InChI | InChI=1S/C7H20N4S/c1-5-8-10-9-6-7(12-4)11(2)3/h7-10H,5-6H2,1-4H3 |
| InChIKey | DNXUWWYRDMSAFS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|