C10H26N4 — CID 90908569
1-[2-[3-(dimethylamino)propyl]hydrazinyl]-N,N-dimethylpropan-2-amine (PubChem CID 90908569) has the molecular formula C10H26N4 and a molecular weight of 202.35 g/mol. Its IUPAC name is 1-[2-[3-(dimethylamino)propyl]hydrazinyl]-N,N-dimethylpropan-2-amine.
| Compound Name | 1-[2-[3-(dimethylamino)propyl]hydrazinyl]-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 90908569 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | 1-[2-[3-(dimethylamino)propyl]hydrazinyl]-N,N-dimethylpropan-2-amine |
| SMILES | CC(CNNCCCN(C)C)N(C)C |
| InChI | InChI=1S/C10H26N4/c1-10(14(4)5)9-12-11-7-6-8-13(2)3/h10-12H,6-9H2,1-5H3 |
| InChIKey | GBWMILFXLHLJCV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|