C8H21N3 — CID 121428596
3-(2-ethyl-2-methylhydrazinyl)-N,N-dimethylpropan-1-amine (PubChem CID 121428596) has the molecular formula C8H21N3 and a molecular weight of 159.28 g/mol. Its IUPAC name is 3-(2-ethyl-2-methylhydrazinyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-ethyl-2-methylhydrazinyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 121428596 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | 3-(2-ethyl-2-methylhydrazinyl)-N,N-dimethylpropan-1-amine |
| SMILES | CCN(C)NCCCN(C)C |
| InChI | InChI=1S/C8H21N3/c1-5-11(4)9-7-6-8-10(2)3/h9H,5-8H2,1-4H3 |
| InChIKey | HKYBFUIYRBAEHL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|