C12H30N4 — CID 57019902
1-N-[3-(dimethylamino)propyl]-1-N',1-N'-diethylpropane-1,1,3-triamine (PubChem CID 57019902) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-1-N',1-N'-diethylpropane-1,1,3-triamine.
| Compound Name | 1-N-[3-(dimethylamino)propyl]-1-N',1-N'-diethylpropane-1,1,3-triamine |
|---|---|
| PubChem CID | 57019902 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-1-N',1-N'-diethylpropane-1,1,3-triamine |
| SMILES | CCN(CC)C(CCN)NCCCN(C)C |
| InChI | InChI=1S/C12H30N4/c1-5-16(6-2)12(8-9-13)14-10-7-11-15(3)4/h12,14H,5-11,13H2,1-4H3 |
| InChIKey | KWAXEDOEGRZZJW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|