C10H26N4 — CID 156769993
3-N-(3-aminopropyl)-5-N,5-N-dimethylpentane-1,3,5-triamine (PubChem CID 156769993) has the molecular formula C10H26N4 and a molecular weight of 202.35 g/mol. Its IUPAC name is 3-N-(3-aminopropyl)-5-N,5-N-dimethylpentane-1,3,5-triamine.
| Compound Name | 3-N-(3-aminopropyl)-5-N,5-N-dimethylpentane-1,3,5-triamine |
|---|---|
| PubChem CID | 156769993 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | 3-N-(3-aminopropyl)-5-N,5-N-dimethylpentane-1,3,5-triamine |
| SMILES | CN(C)CCC(CCN)NCCCN |
| InChI | InChI=1S/C10H26N4/c1-14(2)9-5-10(4-7-12)13-8-3-6-11/h10,13H,3-9,11-12H2,1-2H3 |
| InChIKey | IPUPSCONAGDOQF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|