C16H37N3 — CID 19990016
2-N-dodecylbutane-1,2,4-triamine (PubChem CID 19990016) has the molecular formula C16H37N3 and a molecular weight of 271.49 g/mol. Its IUPAC name is 2-N-dodecylbutane-1,2,4-triamine.
| Compound Name | 2-N-dodecylbutane-1,2,4-triamine |
|---|---|
| PubChem CID | 19990016 |
| Molecular Formula | C16H37N3 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.30 |
| IUPAC Name | 2-N-dodecylbutane-1,2,4-triamine |
| SMILES | CCCCCCCCCCCCNC(CN)CCN |
| InChI | InChI=1S/C16H37N3/c1-2-3-4-5-6-7-8-9-10-11-14-19-16(15-18)12-13-17/h16,19H,2-15,17-18H2,1H3 |
| InChIKey | GIUXUEMQSRHRLW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|