C24H50N2 — CID 118235407
(2S)-4-methyl-2-N-[(Z)-octadec-9-enyl]pentane-1,2-diamine (PubChem CID 118235407) has the molecular formula C24H50N2 and a molecular weight of 366.68 g/mol. Its IUPAC name is (2S)-4-methyl-2-N-[(Z)-octadec-9-enyl]pentane-1,2-diamine.
| Compound Name | (2S)-4-methyl-2-N-[(Z)-octadec-9-enyl]pentane-1,2-diamine |
|---|---|
| PubChem CID | 118235407 |
| Molecular Formula | C24H50N2 |
| Molecular Weight | 366.68 g/mol |
| Exact Mass | 366.40 |
| IUPAC Name | (2S)-4-methyl-2-N-[(Z)-octadec-9-enyl]pentane-1,2-diamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN[C@H](CN)CC(C)C |
| InChI | InChI=1S/C24H50N2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-24(22-25)21-23(2)3/h11-12,23-24,26H,4-10,13-22,25H2,1-3H3/b12-11-/t24-/m0/s1 |
| InChIKey | ZLGTUGYUEPVKNN-IPYQYMIDSA-N |
| XLogP | 6.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.68 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|