C12H32N5+ — CID 18322616
2-(2-aminoethylamino)ethyl-[2-[2-(dimethylamino)ethylamino]ethyl]-dimethylazanium (PubChem CID 18322616) has the molecular formula C12H32N5+ and a molecular weight of 246.42 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethyl-[2-[2-(dimethylamino)ethylamino]ethyl]-dimethylazanium.
| Compound Name | 2-(2-aminoethylamino)ethyl-[2-[2-(dimethylamino)ethylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 18322616 |
| Molecular Formula | C12H32N5+ |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.27 |
| IUPAC Name | 2-(2-aminoethylamino)ethyl-[2-[2-(dimethylamino)ethylamino]ethyl]-dimethylazanium |
| SMILES | CN(C)CCNCC[N+](C)(C)CCNCCN |
| InChI | InChI=1S/C12H32N5/c1-16(2)10-7-15-9-12-17(3,4)11-8-14-6-5-13/h14-15H,5-13H2,1-4H3/q+1 |
| InChIKey | ADJLDZRMWCYRQX-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|