C10H23ClN2 — CID 114526723
N-(2-chloro-3-methylbutyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 114526723) has the molecular formula C10H23ClN2 and a molecular weight of 206.76 g/mol. Its IUPAC name is N-(2-chloro-3-methylbutyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(2-chloro-3-methylbutyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114526723 |
| Molecular Formula | C10H23ClN2 |
| Molecular Weight | 206.76 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | N-(2-chloro-3-methylbutyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(C)C(Cl)CNCCCN(C)C |
| InChI | InChI=1S/C10H23ClN2/c1-9(2)10(11)8-12-6-5-7-13(3)4/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | VAHYCUQMMBMUKG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|