C16H38N4O3 — CID 141061045
2-[2-[2-[2,2-bis(dimethylamino)ethoxy]ethoxy]ethoxy]-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine (PubChem CID 141061045) has the molecular formula C16H38N4O3 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-[2-[2-[2,2-bis(dimethylamino)ethoxy]ethoxy]ethoxy]-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine.
| Compound Name | 2-[2-[2-[2,2-bis(dimethylamino)ethoxy]ethoxy]ethoxy]-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine |
|---|---|
| PubChem CID | 141061045 |
| Molecular Formula | C16H38N4O3 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 2-[2-[2-[2,2-bis(dimethylamino)ethoxy]ethoxy]ethoxy]-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine |
| SMILES | CN(C)C(COCCOCCOCC(N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C16H38N4O3/c1-17(2)15(18(3)4)13-22-11-9-21-10-12-23-14-16(19(5)6)20(7)8/h15-16H,9-14H2,1-8H3 |
| InChIKey | RGXPNFCTRRCDQN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|