C10H25N3O — CID 57098309
2-(1-amino-2-methylpropoxy)-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine (PubChem CID 57098309) has the molecular formula C10H25N3O and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-(1-amino-2-methylpropoxy)-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine.
| Compound Name | 2-(1-amino-2-methylpropoxy)-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine |
|---|---|
| PubChem CID | 57098309 |
| Molecular Formula | C10H25N3O |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.20 |
| IUPAC Name | 2-(1-amino-2-methylpropoxy)-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine |
| SMILES | CC(C)C(N)OCC(N(C)C)N(C)C |
| InChI | InChI=1S/C10H25N3O/c1-8(2)10(11)14-7-9(12(3)4)13(5)6/h8-10H,7,11H2,1-6H3 |
| InChIKey | DKKQMEOBKJNCFS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|