C8H19N — CID 59252919
(4R)-2,4-dimethylhexan-3-amine (PubChem CID 59252919) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is (4R)-2,4-dimethylhexan-3-amine.
| Compound Name | (4R)-2,4-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 59252919 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | (4R)-2,4-dimethylhexan-3-amine |
| SMILES | CC[C@@H](C)C(N)C(C)C |
| InChI | InChI=1S/C8H19N/c1-5-7(4)8(9)6(2)3/h6-8H,5,9H2,1-4H3/t7-,8?/m1/s1 |
| InChIKey | IQQKAZBCYSDOLA-GVHYBUMESA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |