About 2,4-dimethylhexan-3-amine;ethane
2,4-dimethylhexan-3-amine;ethane (PubChem CID 143534901) has the molecular formula C10H25N
and a molecular weight of 159.32 g/mol. Its IUPAC name is 2,4-dimethylhexan-3-amine;ethane.
Molecular Properties
| Compound Name | 2,4-dimethylhexan-3-amine;ethane |
| PubChem CID | 143534901 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | 2,4-dimethylhexan-3-amine;ethane |
| SMILES | CC.CCC(C)C(N)C(C)C |
| InChI | InChI=1S/C8H19N.C2H6/c1-5-7(4)8(9)6(2)3;1-2/h6-8H,5,9H2,1-4H3;1-2H3 |
| InChIKey | RANVGLNPLPOZJT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethylhexan-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylhexan-3-amine;ethane?
The IUPAC name of 2,4-dimethylhexan-3-amine;ethane (CID 143534901) is 2,4-dimethylhexan-3-amine;ethane.
What is the SMILES notation for 2,4-dimethylhexan-3-amine;ethane?
The canonical SMILES for 2,4-dimethylhexan-3-amine;ethane is CC.CCC(C)C(N)C(C)C.
What is the InChIKey of 2,4-dimethylhexan-3-amine;ethane?
The InChIKey is RANVGLNPLPOZJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C2H6/c1-5-7(4)8(9)6(2)3;1-2/h6-8H,5,9H2,1-4H3;1-2H3.
What are the key properties of 2,4-dimethylhexan-3-amine;ethane?
2,4-dimethylhexan-3-amine;ethane has a molecular weight of 159.32 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylhexan-3-amine;ethane is sourced from PubChem (CID 143534901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).