C10H25N — CID 143534901
2,4-dimethylhexan-3-amine;ethane (PubChem CID 143534901) has the molecular formula C10H25N and a molecular weight of 159.32 g/mol. Its IUPAC name is 2,4-dimethylhexan-3-amine;ethane.
| Compound Name | 2,4-dimethylhexan-3-amine;ethane |
|---|---|
| PubChem CID | 143534901 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | 2,4-dimethylhexan-3-amine;ethane |
| SMILES | CC.CCC(C)C(N)C(C)C |
| InChI | InChI=1S/C8H19N.C2H6/c1-5-7(4)8(9)6(2)3;1-2/h6-8H,5,9H2,1-4H3;1-2H3 |
| InChIKey | RANVGLNPLPOZJT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |