C18H42N4O — CID 88747118
4-[6-amino-6-(dimethylamino)-2-methylhexan-3-yl]oxy-1-N',1-N',5-trimethylhexane-1,1-diamine (PubChem CID 88747118) has the molecular formula C18H42N4O and a molecular weight of 330.56 g/mol. Its IUPAC name is 4-[6-amino-6-(dimethylamino)-2-methylhexan-3-yl]oxy-1-N',1-N',5-trimethylhexane-1,1-diamine.
| Compound Name | 4-[6-amino-6-(dimethylamino)-2-methylhexan-3-yl]oxy-1-N',1-N',5-trimethylhexane-1,1-diamine |
|---|---|
| PubChem CID | 88747118 |
| Molecular Formula | C18H42N4O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.34 |
| IUPAC Name | 4-[6-amino-6-(dimethylamino)-2-methylhexan-3-yl]oxy-1-N',1-N',5-trimethylhexane-1,1-diamine |
| SMILES | CC(C)C(CCC(N)N(C)C)OC(CCC(N)N(C)C)C(C)C |
| InChI | InChI=1S/C18H42N4O/c1-13(2)15(9-11-17(19)21(5)6)23-16(14(3)4)10-12-18(20)22(7)8/h13-18H,9-12,19-20H2,1-8H3 |
| InChIKey | PZMRJLZBBCMVRD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|