C12H26O6S2 — CID 134886096
[(3R,6R)-2,7-dimethyl-6-methylsulfonyloxyoctan-3-yl] methanesulfonate (PubChem CID 134886096) has the molecular formula C12H26O6S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(3R,6R)-2,7-dimethyl-6-methylsulfonyloxyoctan-3-yl] methanesulfonate.
| Compound Name | [(3R,6R)-2,7-dimethyl-6-methylsulfonyloxyoctan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 134886096 |
| Molecular Formula | C12H26O6S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [(3R,6R)-2,7-dimethyl-6-methylsulfonyloxyoctan-3-yl] methanesulfonate |
| SMILES | CC(C)[C@@H](CC[C@@H](OS(C)(=O)=O)C(C)C)OS(C)(=O)=O |
| InChI | InChI=1S/C12H26O6S2/c1-9(2)11(17-19(5,13)14)7-8-12(10(3)4)18-20(6,15)16/h9-12H,7-8H2,1-6H3/t11-,12-/m1/s1 |
| InChIKey | KRSSDOHWXOMTQM-VXGBXAGGSA-N |
| XLogP | 1.77 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|