About sodium;hydride;1-hydroxyethyl methanesulfonate
sodium;hydride;1-hydroxyethyl methanesulfonate (PubChem CID 175023295) has the molecular formula C3H9NaO4S
and a molecular weight of 164.16 g/mol. Its IUPAC name is sodium;hydride;1-hydroxyethyl methanesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;1-hydroxyethyl methanesulfonate |
| PubChem CID | 175023295 |
| Molecular Formula | C3H9NaO4S |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | sodium;hydride;1-hydroxyethyl methanesulfonate |
| SMILES | CC(O)OS(C)(=O)=O.[H-].[Na+] |
| InChI | InChI=1S/C3H8O4S.Na.H/c1-3(4)7-8(2,5)6;;/h3-4H,1-2H3;;/q;+1;-1 |
| InChIKey | MPQHXVWCRCJGFW-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1-hydroxyethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1-hydroxyethyl methanesulfonate?
The IUPAC name of sodium;hydride;1-hydroxyethyl methanesulfonate (CID 175023295) is sodium;hydride;1-hydroxyethyl methanesulfonate.
What is the SMILES notation for sodium;hydride;1-hydroxyethyl methanesulfonate?
The canonical SMILES for sodium;hydride;1-hydroxyethyl methanesulfonate is CC(O)OS(C)(=O)=O.[H-].[Na+].
What is the InChIKey of sodium;hydride;1-hydroxyethyl methanesulfonate?
The InChIKey is MPQHXVWCRCJGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O4S.Na.H/c1-3(4)7-8(2,5)6;;/h3-4H,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;1-hydroxyethyl methanesulfonate?
sodium;hydride;1-hydroxyethyl methanesulfonate has a molecular weight of 164.16 g/mol, XLogP of -3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1-hydroxyethyl methanesulfonate is sourced from PubChem (CID 175023295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).