About sodium;dihydroxymethyl ethanesulfonate;hydride
sodium;dihydroxymethyl ethanesulfonate;hydride (PubChem CID 174433605) has the molecular formula C3H9NaO5S
and a molecular weight of 180.16 g/mol. Its IUPAC name is sodium;dihydroxymethyl ethanesulfonate;hydride.
Molecular Properties
| Compound Name | sodium;dihydroxymethyl ethanesulfonate;hydride |
| PubChem CID | 174433605 |
| Molecular Formula | C3H9NaO5S |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | sodium;dihydroxymethyl ethanesulfonate;hydride |
| SMILES | CCS(=O)(=O)OC(O)O.[H-].[Na+] |
| InChI | InChI=1S/C3H8O5S.Na.H/c1-2-9(6,7)8-3(4)5;;/h3-5H,2H2,1H3;;/q;+1;-1 |
| InChIKey | HPEHZNJAHOSEGA-UHFFFAOYSA-N |
| XLogP | -4.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;dihydroxymethyl ethanesulfonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dihydroxymethyl ethanesulfonate;hydride?
The IUPAC name of sodium;dihydroxymethyl ethanesulfonate;hydride (CID 174433605) is sodium;dihydroxymethyl ethanesulfonate;hydride.
What is the SMILES notation for sodium;dihydroxymethyl ethanesulfonate;hydride?
The canonical SMILES for sodium;dihydroxymethyl ethanesulfonate;hydride is CCS(=O)(=O)OC(O)O.[H-].[Na+].
What is the InChIKey of sodium;dihydroxymethyl ethanesulfonate;hydride?
The InChIKey is HPEHZNJAHOSEGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O5S.Na.H/c1-2-9(6,7)8-3(4)5;;/h3-5H,2H2,1H3;;/q;+1;-1.
What are the key properties of sodium;dihydroxymethyl ethanesulfonate;hydride?
sodium;dihydroxymethyl ethanesulfonate;hydride has a molecular weight of 180.16 g/mol, XLogP of -4.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dihydroxymethyl ethanesulfonate;hydride is sourced from PubChem (CID 174433605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).