C8H18O10S2 — CID 98505818
[(2R,3R,4R,5S)-1,2,5,6-tetrahydroxy-4-methylsulfonyloxyhexan-3-yl] methanesulfonate (PubChem CID 98505818) has the molecular formula C8H18O10S2 and a molecular weight of 338.36 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-1,2,5,6-tetrahydroxy-4-methylsulfonyloxyhexan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5S)-1,2,5,6-tetrahydroxy-4-methylsulfonyloxyhexan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 98505818 |
| Molecular Formula | C8H18O10S2 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [(2R,3R,4R,5S)-1,2,5,6-tetrahydroxy-4-methylsulfonyloxyhexan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]([C@H](OS(C)(=O)=O)[C@@H](O)CO)[C@H](O)CO |
| InChI | InChI=1S/C8H18O10S2/c1-19(13,14)17-7(5(11)3-9)8(6(12)4-10)18-20(2,15)16/h5-12H,3-4H2,1-2H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | VGFGPWKIJVCELG-ULAWRXDQSA-N |
| XLogP | -3.62 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|