C12H28O12S2 — CID 23617416
(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;4-methylsulfonyloxybutyl methanesulfonate (PubChem CID 23617416) has the molecular formula C12H28O12S2 and a molecular weight of 428.48 g/mol. Its IUPAC name is (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;4-methylsulfonyloxybutyl methanesulfonate.
| Compound Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;4-methylsulfonyloxybutyl methanesulfonate |
|---|---|
| PubChem CID | 23617416 |
| Molecular Formula | C12H28O12S2 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;4-methylsulfonyloxybutyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCCOS(C)(=O)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14O6S2.C6H14O6/c1-13(7,8)11-5-3-4-6-12-14(2,9)10;7-1-3(9)5(11)6(12)4(10)2-8/h3-6H2,1-2H3;3-12H,1-2H2/t;3-,4-,5-,6-/m.1/s1 |
| InChIKey | NGVVRBOJODHOND-WKWWPMDXSA-N |
| XLogP | -3.87 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|