C8H15NO9S — CID 87496728
[(2R,3R,4R,5R)-5-amino-1,2,4-trihydroxy-6,7-dioxooctan-3-yl] hydrogen sulfate (PubChem CID 87496728) has the molecular formula C8H15NO9S and a molecular weight of 301.27 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-amino-1,2,4-trihydroxy-6,7-dioxooctan-3-yl] hydrogen sulfate.
| Compound Name | [(2R,3R,4R,5R)-5-amino-1,2,4-trihydroxy-6,7-dioxooctan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 87496728 |
| Molecular Formula | C8H15NO9S |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | [(2R,3R,4R,5R)-5-amino-1,2,4-trihydroxy-6,7-dioxooctan-3-yl] hydrogen sulfate |
| SMILES | CC(=O)C(=O)[C@H](N)[C@@H](O)[C@@H](OS(=O)(=O)O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO9S/c1-3(11)6(13)5(9)7(14)8(4(12)2-10)18-19(15,16)17/h4-5,7-8,10,12,14H,2,9H2,1H3,(H,15,16,17)/t4-,5+,7-,8+/m1/s1 |
| InChIKey | AFGHJKUWPJOQGK-ROHCDXGRSA-N |
| XLogP | -3.63 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|