C8H14Br4O6S2 — CID 98532651
[(2S,3S,4R,5S)-1,2,5,6-tetrabromo-4-methylsulfonyloxyhexan-3-yl] methanesulfonate (PubChem CID 98532651) has the molecular formula C8H14Br4O6S2 and a molecular weight of 589.94 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-1,2,5,6-tetrabromo-4-methylsulfonyloxyhexan-3-yl] methanesulfonate.
| Compound Name | [(2S,3S,4R,5S)-1,2,5,6-tetrabromo-4-methylsulfonyloxyhexan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 98532651 |
| Molecular Formula | C8H14Br4O6S2 |
| Molecular Weight | 589.94 g/mol |
| Exact Mass | 585.70 |
| IUPAC Name | [(2S,3S,4R,5S)-1,2,5,6-tetrabromo-4-methylsulfonyloxyhexan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]([C@H](OS(C)(=O)=O)[C@H](Br)CBr)[C@H](Br)CBr |
| InChI | InChI=1S/C8H14Br4O6S2/c1-19(13,14)17-7(5(11)3-9)8(6(12)4-10)18-20(2,15)16/h5-8H,3-4H2,1-2H3/t5-,6-,7-,8+/m1/s1 |
| InChIKey | LCEGZGDJLWWHTG-XUTVFYLZSA-N |
| XLogP | 1.99 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.94 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|