methyl 2-methylsulfonyloxypropanoate

C5H10O5S — CID 11480830

IUPACmethyl 2-methylsulfonyloxypropanoate
SMILESCOC(=O)C(C)OS(C)(=O)=O
InChIInChI=1S/C5H10O5S/c1-4(5(6)9-2)10-11(3,7)8/h4H,1-3H3
InChIKeyXEUQMYXHUMKCJY-UHFFFAOYSA-N
MW182.20 g/mol
LogP-0.48
Rot. Bonds3

About methyl 2-methylsulfonyloxypropanoate

methyl 2-methylsulfonyloxypropanoate (PubChem CID 11480830) has the molecular formula C5H10O5S and a molecular weight of 182.20 g/mol. Its IUPAC name is methyl 2-methylsulfonyloxypropanoate.

Molecular Properties

Compound Namemethyl 2-methylsulfonyloxypropanoate
PubChem CID11480830
Molecular FormulaC5H10O5S
Molecular Weight182.20 g/mol
Exact Mass182.02
IUPAC Namemethyl 2-methylsulfonyloxypropanoate
SMILESCOC(=O)C(C)OS(C)(=O)=O
InChIInChI=1S/C5H10O5S/c1-4(5(6)9-2)10-11(3,7)8/h4H,1-3H3
InChIKeyXEUQMYXHUMKCJY-UHFFFAOYSA-N
XLogP-0.48
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.20
LogP ≤ 5-0.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze methyl 2-methylsulfonyloxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methylsulfonyloxypropanoate?
The IUPAC name of methyl 2-methylsulfonyloxypropanoate (CID 11480830) is methyl 2-methylsulfonyloxypropanoate.
What is the SMILES notation for methyl 2-methylsulfonyloxypropanoate?
The canonical SMILES for methyl 2-methylsulfonyloxypropanoate is COC(=O)C(C)OS(C)(=O)=O.
What is the InChIKey of methyl 2-methylsulfonyloxypropanoate?
The InChIKey is XEUQMYXHUMKCJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5S/c1-4(5(6)9-2)10-11(3,7)8/h4H,1-3H3.
What are the key properties of methyl 2-methylsulfonyloxypropanoate?
methyl 2-methylsulfonyloxypropanoate has a molecular weight of 182.20 g/mol, XLogP of -0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylsulfonyloxypropanoate is sourced from PubChem (CID 11480830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).