C8H15NO6S — CID 10848476
methyl (2S,3S)-2-acetamido-3-methylsulfonyloxybutanoate (PubChem CID 10848476) has the molecular formula C8H15NO6S and a molecular weight of 253.28 g/mol. Its IUPAC name is methyl (2S,3S)-2-acetamido-3-methylsulfonyloxybutanoate.
| Compound Name | methyl (2S,3S)-2-acetamido-3-methylsulfonyloxybutanoate |
|---|---|
| PubChem CID | 10848476 |
| Molecular Formula | C8H15NO6S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | methyl (2S,3S)-2-acetamido-3-methylsulfonyloxybutanoate |
| SMILES | COC(=O)[C@@H](NC(C)=O)[C@H](C)OS(C)(=O)=O |
| InChI | InChI=1S/C8H15NO6S/c1-5(15-16(4,12)13)7(8(11)14-3)9-6(2)10/h5,7H,1-4H3,(H,9,10)/t5-,7-/m0/s1 |
| InChIKey | UDERCEMLYGXYCP-FSPLSTOPSA-N |
| XLogP | -0.97 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|