C9H17NO4 — CID 11367693
methyl (2S,3S)-2-acetamido-3-hydroxy-4-methylpentanoate (PubChem CID 11367693) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl (2S,3S)-2-acetamido-3-hydroxy-4-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-acetamido-3-hydroxy-4-methylpentanoate |
|---|---|
| PubChem CID | 11367693 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | methyl (2S,3S)-2-acetamido-3-hydroxy-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](NC(C)=O)[C@@H](O)C(C)C |
| InChI | InChI=1S/C9H17NO4/c1-5(2)8(12)7(9(13)14-4)10-6(3)11/h5,7-8,12H,1-4H3,(H,10,11)/t7-,8-/m0/s1 |
| InChIKey | PWRLPCCEIDTPTQ-YUMQZZPRSA-N |
| XLogP | -0.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |