C9H20NO5P — CID 125471797
N-[(1S,2R)-1-dimethoxyphosphoryl-2-hydroxy-3-methylbutyl]acetamide (PubChem CID 125471797) has the molecular formula C9H20NO5P and a molecular weight of 253.23 g/mol. Its IUPAC name is N-[(1S,2R)-1-dimethoxyphosphoryl-2-hydroxy-3-methylbutyl]acetamide.
| Compound Name | N-[(1S,2R)-1-dimethoxyphosphoryl-2-hydroxy-3-methylbutyl]acetamide |
|---|---|
| PubChem CID | 125471797 |
| Molecular Formula | C9H20NO5P |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[(1S,2R)-1-dimethoxyphosphoryl-2-hydroxy-3-methylbutyl]acetamide |
| SMILES | COP(=O)(OC)[C@H](NC(C)=O)[C@H](O)C(C)C |
| InChI | InChI=1S/C9H20NO5P/c1-6(2)8(12)9(10-7(3)11)16(13,14-4)15-5/h6,8-9,12H,1-5H3,(H,10,11)/t8-,9+/m1/s1 |
| InChIKey | WUWZQPPDSWQCTB-BDAKNGLRSA-N |
| XLogP | 0.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|