C6H14NO5P — CID 10104576
[(1R)-1-[[(2R)-2-hydroxypropanoyl]amino]ethyl]-methoxyphosphinic acid (PubChem CID 10104576) has the molecular formula C6H14NO5P and a molecular weight of 211.15 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-hydroxypropanoyl]amino]ethyl]-methoxyphosphinic acid.
| Compound Name | [(1R)-1-[[(2R)-2-hydroxypropanoyl]amino]ethyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 10104576 |
| Molecular Formula | C6H14NO5P |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | [(1R)-1-[[(2R)-2-hydroxypropanoyl]amino]ethyl]-methoxyphosphinic acid |
| SMILES | COP(=O)(O)[C@H](C)NC(=O)[C@@H](C)O |
| InChI | InChI=1S/C6H14NO5P/c1-4(8)6(9)7-5(2)13(10,11)12-3/h4-5,8H,1-3H3,(H,7,9)(H,10,11)/t4-,5-/m1/s1 |
| InChIKey | WDKSOVZQXJIZAV-RFZPGFLSSA-N |
| XLogP | -0.34 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|