C14H28N2O13P2 — CID 10368460
[(1R)-1-[[(2R)-2-[(2R,3S,4R,5R,6S)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-phosphonooxyoxan-4-yl]oxypropanoyl]amino]ethyl]-methoxyphosphinic acid (PubChem CID 10368460) has the molecular formula C14H28N2O13P2 and a molecular weight of 494.33 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-[(2R,3S,4R,5R,6S)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-phosphonooxyoxan-4-yl]oxypropanoyl]amino]ethyl]-methoxyphosphinic acid.
| Compound Name | [(1R)-1-[[(2R)-2-[(2R,3S,4R,5R,6S)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-phosphonooxyoxan-4-yl]oxypropanoyl]amino]ethyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 10368460 |
| Molecular Formula | C14H28N2O13P2 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | [(1R)-1-[[(2R)-2-[(2R,3S,4R,5R,6S)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-phosphonooxyoxan-4-yl]oxypropanoyl]amino]ethyl]-methoxyphosphinic acid |
| SMILES | COP(=O)(O)[C@H](C)NC(=O)[C@@H](C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](OP(=O)(O)O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C14H28N2O13P2/c1-6(13(20)16-8(3)30(21,22)26-4)27-12-10(15-7(2)18)14(29-31(23,24)25)28-9(5-17)11(12)19/h6,8-12,14,17,19H,5H2,1-4H3,(H,15,18)(H,16,20)(H,21,22)(H2,23,24,25)/t6-,8-,9-,10-,11-,12-,14+/m1/s1 |
| InChIKey | RYSONDOFKQLPSJ-MADWNJRKSA-N |
| XLogP | -2.25 |
| TPSA | 230.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|