C13H26N2O13P2 — CID 10480279
[(1R)-1-[[(2R)-2-[(2R,3S,4R,5R,6R)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-phosphonooxyoxan-4-yl]oxypropanoyl]amino]ethyl]phosphonic acid (PubChem CID 10480279) has the molecular formula C13H26N2O13P2 and a molecular weight of 480.30 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-[(2R,3S,4R,5R,6R)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-phosphonooxyoxan-4-yl]oxypropanoyl]amino]ethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R)-2-[(2R,3S,4R,5R,6R)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-phosphonooxyoxan-4-yl]oxypropanoyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 10480279 |
| Molecular Formula | C13H26N2O13P2 |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [(1R)-1-[[(2R)-2-[(2R,3S,4R,5R,6R)-5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-phosphonooxyoxan-4-yl]oxypropanoyl]amino]ethyl]phosphonic acid |
| SMILES | CC(=O)N[C@H]1[C@@H](OP(=O)(O)O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H](C)C(=O)N[C@@H](C)P(=O)(O)O |
| InChI | InChI=1S/C13H26N2O13P2/c1-5(12(19)15-7(3)29(20,21)22)26-11-9(14-6(2)17)13(28-30(23,24)25)27-8(4-16)10(11)18/h5,7-11,13,16,18H,4H2,1-3H3,(H,14,17)(H,15,19)(H2,20,21,22)(H2,23,24,25)/t5-,7-,8-,9-,10-,11-,13-/m1/s1 |
| InChIKey | AUEAZZZWQSPLJB-RTJKPAGFSA-N |
| XLogP | -2.91 |
| TPSA | 241.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|