C10H20NO9P — CID 101399420
[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2-methylpropanoylamino)oxan-2-yl] dihydrogen phosphate (PubChem CID 101399420) has the molecular formula C10H20NO9P and a molecular weight of 329.24 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2-methylpropanoylamino)oxan-2-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2-methylpropanoylamino)oxan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101399420 |
| Molecular Formula | C10H20NO9P |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2-methylpropanoylamino)oxan-2-yl] dihydrogen phosphate |
| SMILES | CC(C)C(=O)N[C@H]1[C@@H](OP(=O)(O)O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20NO9P/c1-4(2)9(15)11-6-8(14)7(13)5(3-12)19-10(6)20-21(16,17)18/h4-8,10,12-14H,3H2,1-2H3,(H,11,15)(H2,16,17,18)/t5-,6-,7-,8-,10-/m1/s1 |
| InChIKey | BCZDIRVBOQDJEE-VRRGKTLJSA-N |
| XLogP | -2.32 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|