C5H13O5P — CID 42612314
(1S,2S)-1-dimethoxyphosphorylpropane-1,2-diol (PubChem CID 42612314) has the molecular formula C5H13O5P and a molecular weight of 184.13 g/mol. Its IUPAC name is (1S,2S)-1-dimethoxyphosphorylpropane-1,2-diol.
| Compound Name | (1S,2S)-1-dimethoxyphosphorylpropane-1,2-diol |
|---|---|
| PubChem CID | 42612314 |
| Molecular Formula | C5H13O5P |
| Molecular Weight | 184.13 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (1S,2S)-1-dimethoxyphosphorylpropane-1,2-diol |
| SMILES | COP(=O)(OC)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C5H13O5P/c1-4(6)5(7)11(8,9-2)10-3/h4-7H,1-3H3/t4-,5-/m0/s1 |
| InChIKey | NPILGPDIMQWKHY-WHFBIAKZSA-N |
| XLogP | 0.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.13 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|