C11H17O4P — CID 125471602
(1R,2R)-1-dimethoxyphosphoryl-2-phenylpropan-1-ol (PubChem CID 125471602) has the molecular formula C11H17O4P and a molecular weight of 244.23 g/mol. Its IUPAC name is (1R,2R)-1-dimethoxyphosphoryl-2-phenylpropan-1-ol.
| Compound Name | (1R,2R)-1-dimethoxyphosphoryl-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 125471602 |
| Molecular Formula | C11H17O4P |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (1R,2R)-1-dimethoxyphosphoryl-2-phenylpropan-1-ol |
| SMILES | COP(=O)(OC)[C@@H](O)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C11H17O4P/c1-9(10-7-5-4-6-8-10)11(12)16(13,14-2)15-3/h4-9,11-12H,1-3H3/t9-,11-/m1/s1 |
| InChIKey | OBSURBBCOPEUCN-MWLCHTKSSA-N |
| XLogP | 2.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|