C8H15NO7S — CID 23347659
2-acetamido-4-methoxy-3-methylsulfonyloxybutanoic acid (PubChem CID 23347659) has the molecular formula C8H15NO7S and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-acetamido-4-methoxy-3-methylsulfonyloxybutanoic acid.
| Compound Name | 2-acetamido-4-methoxy-3-methylsulfonyloxybutanoic acid |
|---|---|
| PubChem CID | 23347659 |
| Molecular Formula | C8H15NO7S |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-acetamido-4-methoxy-3-methylsulfonyloxybutanoic acid |
| SMILES | COCC(OS(C)(=O)=O)C(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H15NO7S/c1-5(10)9-7(8(11)12)6(4-15-2)16-17(3,13)14/h6-7H,4H2,1-3H3,(H,9,10)(H,11,12) |
| InChIKey | XKMJWVVFMOXXLK-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|