C14H27NO9S — CID 155896468
2-methylpropan-2-amine;2-[2-(2-methylsulfonyloxypropanoyloxy)propanoyloxy]propanoic acid (PubChem CID 155896468) has the molecular formula C14H27NO9S and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-methylpropan-2-amine;2-[2-(2-methylsulfonyloxypropanoyloxy)propanoyloxy]propanoic acid.
| Compound Name | 2-methylpropan-2-amine;2-[2-(2-methylsulfonyloxypropanoyloxy)propanoyloxy]propanoic acid |
|---|---|
| PubChem CID | 155896468 |
| Molecular Formula | C14H27NO9S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-methylpropan-2-amine;2-[2-(2-methylsulfonyloxypropanoyloxy)propanoyloxy]propanoic acid |
| SMILES | CC(C)(C)N.CC(OC(=O)C(C)OC(=O)C(C)OS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H16O9S.C4H11N/c1-5(8(11)12)17-9(13)6(2)18-10(14)7(3)19-20(4,15)16;1-4(2,3)5/h5-7H,1-4H3,(H,11,12);5H2,1-3H3 |
| InChIKey | MRGKKMMWSIFRNM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 159.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|