C4H11O7PS — CID 18639918
[(1S,2S)-2-hydroxy-1-methylsulfonyloxypropyl]phosphonic acid (PubChem CID 18639918) has the molecular formula C4H11O7PS and a molecular weight of 234.17 g/mol. Its IUPAC name is [(1S,2S)-2-hydroxy-1-methylsulfonyloxypropyl]phosphonic acid.
| Compound Name | [(1S,2S)-2-hydroxy-1-methylsulfonyloxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 18639918 |
| Molecular Formula | C4H11O7PS |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | [(1S,2S)-2-hydroxy-1-methylsulfonyloxypropyl]phosphonic acid |
| SMILES | C[C@H](O)[C@@H](OS(C)(=O)=O)P(=O)(O)O |
| InChI | InChI=1S/C4H11O7PS/c1-3(5)4(12(6,7)8)11-13(2,9)10/h3-5H,1-2H3,(H2,6,7,8)/t3-,4-/m0/s1 |
| InChIKey | KTZHKSQSCPHHMC-IMJSIDKUSA-N |
| XLogP | -1.15 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|