C10H16F8N2O3 — CID 131974281
2-[2-[2-[2-(difluoroamino)-1,1,2-trifluoroethoxy]ethoxy]ethoxy]-1,2,2-trifluoro-N,N-dimethylethanamine (PubChem CID 131974281) has the molecular formula C10H16F8N2O3 and a molecular weight of 364.23 g/mol. Its IUPAC name is 2-[2-[2-[2-(difluoroamino)-1,1,2-trifluoroethoxy]ethoxy]ethoxy]-1,2,2-trifluoro-N,N-dimethylethanamine.
| Compound Name | 2-[2-[2-[2-(difluoroamino)-1,1,2-trifluoroethoxy]ethoxy]ethoxy]-1,2,2-trifluoro-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 131974281 |
| Molecular Formula | C10H16F8N2O3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-[2-[2-[2-(difluoroamino)-1,1,2-trifluoroethoxy]ethoxy]ethoxy]-1,2,2-trifluoro-N,N-dimethylethanamine |
| SMILES | CN(C)C(F)C(F)(F)OCCOCCOC(F)(F)C(F)N(F)F |
| InChI | InChI=1S/C10H16F8N2O3/c1-19(2)7(11)9(13,14)22-5-3-21-4-6-23-10(15,16)8(12)20(17)18/h7-8H,3-6H2,1-2H3 |
| InChIKey | FAWYWVVFZBLQPJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|