About 1-(dimethylamino)decane-1,10-diol
1-(dimethylamino)decane-1,10-diol (PubChem CID 139819105) has the molecular formula C12H27NO2
and a molecular weight of 217.35 g/mol. Its IUPAC name is 1-(dimethylamino)decane-1,10-diol.
Molecular Properties
| Compound Name | 1-(dimethylamino)decane-1,10-diol |
| PubChem CID | 139819105 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1-(dimethylamino)decane-1,10-diol |
| SMILES | CN(C)C(O)CCCCCCCCCO |
| InChI | InChI=1S/C12H27NO2/c1-13(2)12(15)10-8-6-4-3-5-7-9-11-14/h12,14-15H,3-11H2,1-2H3 |
| InChIKey | KXJOQOLZLCNEQI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)decane-1,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)decane-1,10-diol?
The IUPAC name of 1-(dimethylamino)decane-1,10-diol (CID 139819105) is 1-(dimethylamino)decane-1,10-diol.
What is the SMILES notation for 1-(dimethylamino)decane-1,10-diol?
The canonical SMILES for 1-(dimethylamino)decane-1,10-diol is CN(C)C(O)CCCCCCCCCO.
What is the InChIKey of 1-(dimethylamino)decane-1,10-diol?
The InChIKey is KXJOQOLZLCNEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2/c1-13(2)12(15)10-8-6-4-3-5-7-9-11-14/h12,14-15H,3-11H2,1-2H3.
What are the key properties of 1-(dimethylamino)decane-1,10-diol?
1-(dimethylamino)decane-1,10-diol has a molecular weight of 217.35 g/mol, XLogP of 1.98, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)decane-1,10-diol is sourced from PubChem (CID 139819105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).