C13H28N2 — CID 43205547
1-N-cyclohexyl-2-N,2-N,3-trimethylbutane-1,2-diamine (PubChem CID 43205547) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-N-cyclohexyl-2-N,2-N,3-trimethylbutane-1,2-diamine.
| Compound Name | 1-N-cyclohexyl-2-N,2-N,3-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 43205547 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1-N-cyclohexyl-2-N,2-N,3-trimethylbutane-1,2-diamine |
| SMILES | CC(C)C(CNC1CCCCC1)N(C)C |
| InChI | InChI=1S/C13H28N2/c1-11(2)13(15(3)4)10-14-12-8-6-5-7-9-12/h11-14H,5-10H2,1-4H3 |
| InChIKey | ZWMFODCSDGIECC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |