C11H23N — CID 59085010
N-[(2S)-2,3-dimethylbutyl]cyclopentanamine (PubChem CID 59085010) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is N-[(2S)-2,3-dimethylbutyl]cyclopentanamine.
| Compound Name | N-[(2S)-2,3-dimethylbutyl]cyclopentanamine |
|---|---|
| PubChem CID | 59085010 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N-[(2S)-2,3-dimethylbutyl]cyclopentanamine |
| SMILES | CC(C)[C@H](C)CNC1CCCC1 |
| InChI | InChI=1S/C11H23N/c1-9(2)10(3)8-12-11-6-4-5-7-11/h9-12H,4-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | DKTWNZJJEOYHRS-SNVBAGLBSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |