About 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine
4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine (PubChem CID 64570673) has the molecular formula C16H33N
and a molecular weight of 239.45 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine |
| PubChem CID | 64570673 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine |
| SMILES | CC(C)C(C)CNC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H33N/c1-12(2)13(3)11-17-15-9-7-14(8-10-15)16(4,5)6/h12-15,17H,7-11H2,1-6H3 |
| InChIKey | WSUUFYVUECXURC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine?
The IUPAC name of 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine (CID 64570673) is 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine.
What is the SMILES notation for 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine?
The canonical SMILES for 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine is CC(C)C(C)CNC1CCC(C(C)(C)C)CC1.
What is the InChIKey of 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine?
The InChIKey is WSUUFYVUECXURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N/c1-12(2)13(3)11-17-15-9-7-14(8-10-15)16(4,5)6/h12-15,17H,7-11H2,1-6H3.
What are the key properties of 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine?
4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine has a molecular weight of 239.45 g/mol, XLogP of 4.47, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(2,3-dimethylbutyl)cyclohexan-1-amine is sourced from PubChem (CID 64570673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).