C20H33N — CID 65090143
4-tert-butyl-N-(2-phenylpropyl)cycloheptan-1-amine (PubChem CID 65090143) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-phenylpropyl)cycloheptan-1-amine.
| Compound Name | 4-tert-butyl-N-(2-phenylpropyl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 65090143 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 4-tert-butyl-N-(2-phenylpropyl)cycloheptan-1-amine |
| SMILES | CC(CNC1CCCC(C(C)(C)C)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H33N/c1-16(17-9-6-5-7-10-17)15-21-19-12-8-11-18(13-14-19)20(2,3)4/h5-7,9-10,16,18-19,21H,8,11-15H2,1-4H3 |
| InChIKey | YNZAZMOYPZPIQA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |