C16H23F3N2 — CID 43769154
N-(2-phenylpropyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 43769154) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is N-(2-phenylpropyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(2-phenylpropyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 43769154 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(2-phenylpropyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | CC(CNC1CCN(CC(F)(F)F)CC1)c1ccccc1 |
| InChI | InChI=1S/C16H23F3N2/c1-13(14-5-3-2-4-6-14)11-20-15-7-9-21(10-8-15)12-16(17,18)19/h2-6,13,15,20H,7-12H2,1H3 |
| InChIKey | QDCBNUIFURJWSN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |