C15H21F3N2O — CID 43791625
3-[1-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethyl]phenol (PubChem CID 43791625) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-[1-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethyl]phenol.
| Compound Name | 3-[1-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 43791625 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-[1-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethyl]phenol |
| SMILES | CC(NC1CCN(CC(F)(F)F)CC1)c1cccc(O)c1 |
| InChI | InChI=1S/C15H21F3N2O/c1-11(12-3-2-4-14(21)9-12)19-13-5-7-20(8-6-13)10-15(16,17)18/h2-4,9,11,13,19,21H,5-8,10H2,1H3 |
| InChIKey | GRWXHNMGDBRAHY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |