C7H19N2OP — CID 59971907
(2R,3S)-3-(dimethylamino)-1-[methyl(phosphanyl)amino]butan-2-ol (PubChem CID 59971907) has the molecular formula C7H19N2OP and a molecular weight of 178.22 g/mol. Its IUPAC name is (2R,3S)-3-(dimethylamino)-1-[methyl(phosphanyl)amino]butan-2-ol.
| Compound Name | (2R,3S)-3-(dimethylamino)-1-[methyl(phosphanyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 59971907 |
| Molecular Formula | C7H19N2OP |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (2R,3S)-3-(dimethylamino)-1-[methyl(phosphanyl)amino]butan-2-ol |
| SMILES | C[C@@H]([C@H](O)CN(C)P)N(C)C |
| InChI | InChI=1S/C7H19N2OP/c1-6(8(2)3)7(10)5-9(4)11/h6-7,10H,5,11H2,1-4H3/t6-,7+/m0/s1 |
| InChIKey | AISADAJQTWZMDK-NKWVEPMBSA-N |
| XLogP | 0.02 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|