About copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol
copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol (PubChem CID 169074035) has the molecular formula C7H14CuF3NO
and a molecular weight of 248.74 g/mol. Its IUPAC name is copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol.
Molecular Properties
| Compound Name | copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol |
| PubChem CID | 169074035 |
| Molecular Formula | C7H14CuF3NO |
| Molecular Weight | 248.74 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol |
| SMILES | CC(C(O)CC(F)(F)F)N(C)C.[Cu] |
| InChI | InChI=1S/C7H14F3NO.Cu/c1-5(11(2)3)6(12)4-7(8,9)10;/h5-6,12H,4H2,1-3H3; |
| InChIKey | QOWVNWLARYRNAX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.74 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol?
The IUPAC name of copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol (CID 169074035) is copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol.
What is the SMILES notation for copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol?
The canonical SMILES for copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol is CC(C(O)CC(F)(F)F)N(C)C.[Cu].
What is the InChIKey of copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol?
The InChIKey is QOWVNWLARYRNAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3NO.Cu/c1-5(11(2)3)6(12)4-7(8,9)10;/h5-6,12H,4H2,1-3H3;.
What are the key properties of copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol?
copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol has a molecular weight of 248.74 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;4-(dimethylamino)-1,1,1-trifluoropentan-3-ol is sourced from PubChem (CID 169074035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).