C14H30O — CID 156689827
2,3,10-trimethylundecan-4-ol (PubChem CID 156689827) has the molecular formula C14H30O and a molecular weight of 214.39 g/mol. Its IUPAC name is 2,3,10-trimethylundecan-4-ol.
| Compound Name | 2,3,10-trimethylundecan-4-ol |
|---|---|
| PubChem CID | 156689827 |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.23 |
| IUPAC Name | 2,3,10-trimethylundecan-4-ol |
| SMILES | CC(C)CCCCCC(O)C(C)C(C)C |
| InChI | InChI=1S/C14H30O/c1-11(2)9-7-6-8-10-14(15)13(5)12(3)4/h11-15H,6-10H2,1-5H3 |
| InChIKey | YFZISXRTEBQLBX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|