C11H22O2 — CID 157142869
5-hydroxy-2,6,7-trimethyloctan-3-one (PubChem CID 157142869) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 5-hydroxy-2,6,7-trimethyloctan-3-one.
| Compound Name | 5-hydroxy-2,6,7-trimethyloctan-3-one |
|---|---|
| PubChem CID | 157142869 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 5-hydroxy-2,6,7-trimethyloctan-3-one |
| SMILES | CC(C)C(=O)CC(O)C(C)C(C)C |
| InChI | InChI=1S/C11H22O2/c1-7(2)9(5)11(13)6-10(12)8(3)4/h7-9,11,13H,6H2,1-5H3 |
| InChIKey | NKEOGECGQDPBDT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |