C6H12O3S2 — CID 142967324
4,5-dihydroxy-1,1-bis(sulfanyl)hexan-2-one (PubChem CID 142967324) has the molecular formula C6H12O3S2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 4,5-dihydroxy-1,1-bis(sulfanyl)hexan-2-one.
| Compound Name | 4,5-dihydroxy-1,1-bis(sulfanyl)hexan-2-one |
|---|---|
| PubChem CID | 142967324 |
| Molecular Formula | C6H12O3S2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4,5-dihydroxy-1,1-bis(sulfanyl)hexan-2-one |
| SMILES | CC(O)C(O)CC(=O)C(S)S |
| InChI | InChI=1S/C6H12O3S2/c1-3(7)4(8)2-5(9)6(10)11/h3-4,6-8,10-11H,2H2,1H3 |
| InChIKey | MAVLSRIEGSWHOH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|